C19H27N3O2S — CID 97313379
N-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-2-(4-ethoxypiperidin-1-yl)acetamide (PubChem CID 97313379) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-2-(4-ethoxypiperidin-1-yl)acetamide.
| Compound Name | N-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-2-(4-ethoxypiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 97313379 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-2-(4-ethoxypiperidin-1-yl)acetamide |
| SMILES | CCOC1CCN(CC(=O)Nc2ccccc2S[C@H](C)CC#N)CC1 |
| InChI | InChI=1S/C19H27N3O2S/c1-3-24-16-9-12-22(13-10-16)14-19(23)21-17-6-4-5-7-18(17)25-15(2)8-11-20/h4-7,15-16H,3,8-10,12-14H2,1-2H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | CADRJRSYPBXBGQ-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |