C19H19Cl2N3O2 — CID 75468061
4-[(cyclopentanecarbonylamino)methyl]-N-(4,5-dichloro-2-pyridinyl)benzamide (PubChem CID 75468061) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 4-[(cyclopentanecarbonylamino)methyl]-N-(4,5-dichloro-2-pyridinyl)benzamide.
| Compound Name | 4-[(cyclopentanecarbonylamino)methyl]-N-(4,5-dichloro-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 75468061 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 4-[(cyclopentanecarbonylamino)methyl]-N-(4,5-dichloro-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cn1)c1ccc(CNC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c20-15-9-17(22-11-16(15)21)24-19(26)14-7-5-12(6-8-14)10-23-18(25)13-3-1-2-4-13/h5-9,11,13H,1-4,10H2,(H,23,25)(H,22,24,26) |
| InChIKey | VJJZBTZWSZGWIP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |