C13H20Cl2N4O — CID 75469364
[3-(aminomethyl)piperidin-1-yl]-[2-chloro-6-(methylamino)-4-pyridinyl]methanone;hydrochloride (PubChem CID 75469364) has the molecular formula C13H20Cl2N4O and a molecular weight of 319.24 g/mol. Its IUPAC name is [3-(aminomethyl)piperidin-1-yl]-[2-chloro-6-(methylamino)-4-pyridinyl]methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)piperidin-1-yl]-[2-chloro-6-(methylamino)-4-pyridinyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 75469364 |
| Molecular Formula | C13H20Cl2N4O |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [3-(aminomethyl)piperidin-1-yl]-[2-chloro-6-(methylamino)-4-pyridinyl]methanone;hydrochloride |
| SMILES | CNc1cc(C(=O)N2CCCC(CN)C2)cc(Cl)n1.Cl |
| InChI | InChI=1S/C13H19ClN4O.ClH/c1-16-12-6-10(5-11(14)17-12)13(19)18-4-2-3-9(7-15)8-18;/h5-6,9H,2-4,7-8,15H2,1H3,(H,16,17);1H |
| InChIKey | WXUNDGRFJFATNF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|