C13H16ClN3O3 — CID 99718166
(3R)-1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidine-3-carboxylic acid (PubChem CID 99718166) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is (3R)-1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 99718166 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (3R)-1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidine-3-carboxylic acid |
| SMILES | CNc1cc(C(=O)N2CCC[C@@H](C(=O)O)C2)cc(Cl)n1 |
| InChI | InChI=1S/C13H16ClN3O3/c1-15-11-6-9(5-10(14)16-11)12(18)17-4-2-3-8(7-17)13(19)20/h5-6,8H,2-4,7H2,1H3,(H,15,16)(H,19,20)/t8-/m1/s1 |
| InChIKey | YLUNZVWKHZFOPS-MRVPVSSYSA-N |
| XLogP | 1.71 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|