C19H17ClF3N3O2 — CID 86953552
[1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidin-4-yl]-(2,4,6-trifluorophenyl)methanone (PubChem CID 86953552) has the molecular formula C19H17ClF3N3O2 and a molecular weight of 411.81 g/mol. Its IUPAC name is [1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidin-4-yl]-(2,4,6-trifluorophenyl)methanone.
| Compound Name | [1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidin-4-yl]-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 86953552 |
| Molecular Formula | C19H17ClF3N3O2 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [1-[2-chloro-6-(methylamino)pyridine-4-carbonyl]piperidin-4-yl]-(2,4,6-trifluorophenyl)methanone |
| SMILES | CNc1cc(C(=O)N2CCC(C(=O)c3c(F)cc(F)cc3F)CC2)cc(Cl)n1 |
| InChI | InChI=1S/C19H17ClF3N3O2/c1-24-16-7-11(6-15(20)25-16)19(28)26-4-2-10(3-5-26)18(27)17-13(22)8-12(21)9-14(17)23/h6-10H,2-5H2,1H3,(H,24,25) |
| InChIKey | UVKJKANOCBTIHX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|