C18H32N4O2 — CID 75470809
2-[4-[2-[3-(methoxymethyl)piperidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile (PubChem CID 75470809) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-[4-[2-[3-(methoxymethyl)piperidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile.
| Compound Name | 2-[4-[2-[3-(methoxymethyl)piperidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 75470809 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-[4-[2-[3-(methoxymethyl)piperidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile |
| SMILES | COCC1CCCN(CC(=O)N2CCN(C(C#N)C(C)C)CC2)C1 |
| InChI | InChI=1S/C18H32N4O2/c1-15(2)17(11-19)21-7-9-22(10-8-21)18(23)13-20-6-4-5-16(12-20)14-24-3/h15-17H,4-10,12-14H2,1-3H3 |
| InChIKey | OYZIHKZXNWPGMY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |