C16H28N4O2 — CID 75515586
2-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile (PubChem CID 75515586) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile.
| Compound Name | 2-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 75515586 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]acetyl]piperazin-1-yl]-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)N1CCN(C(=O)CN2CCC(CO)C2)CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-13(2)15(9-17)19-5-7-20(8-6-19)16(22)11-18-4-3-14(10-18)12-21/h13-15,21H,3-8,10-12H2,1-2H3 |
| InChIKey | YNCZWEZSEQKQRX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |