C17H26N2O3S — CID 75471432
N-(2,4-dimethylphenyl)-3-[(1,1-dioxothiolan-2-yl)methylamino]butanamide (PubChem CID 75471432) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[(1,1-dioxothiolan-2-yl)methylamino]butanamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[(1,1-dioxothiolan-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 75471432 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[(1,1-dioxothiolan-2-yl)methylamino]butanamide |
| SMILES | Cc1ccc(NC(=O)CC(C)NCC2CCCS2(=O)=O)c(C)c1 |
| InChI | InChI=1S/C17H26N2O3S/c1-12-6-7-16(13(2)9-12)19-17(20)10-14(3)18-11-15-5-4-8-23(15,21)22/h6-7,9,14-15,18H,4-5,8,10-11H2,1-3H3,(H,19,20) |
| InChIKey | UREDVQBSNCSMDS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |