C18H17NO5 — CID 75472197
5-[[2-(1-benzofuran-2-yl)propanoylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 75472197) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-[[2-(1-benzofuran-2-yl)propanoylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[2-(1-benzofuran-2-yl)propanoylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 75472197 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 5-[[2-(1-benzofuran-2-yl)propanoylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)C(C)c2cc3ccccc3o2)cc1C(=O)O |
| InChI | InChI=1S/C18H17NO5/c1-10(16-7-12-5-3-4-6-15(12)24-16)17(20)19-9-13-8-14(18(21)22)11(2)23-13/h3-8,10H,9H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | YVPREKVIBUAUQC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |