C16H26N4OS — CID 75472303
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(1,3-thiazol-2-yl)piperidin-4-amine (PubChem CID 75472303) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(1,3-thiazol-2-yl)piperidin-4-amine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(1,3-thiazol-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 75472303 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(1,3-thiazol-2-yl)piperidin-4-amine |
| SMILES | c1csc(N2CCC(NCC3CN4CCCC4CO3)CC2)n1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-14-12-21-15(11-20(14)6-1)10-18-13-3-7-19(8-4-13)16-17-5-9-22-16/h5,9,13-15,18H,1-4,6-8,10-12H2 |
| InChIKey | RWSGTOYPMBCUBH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |