C13H24N2OS — CID 79950813
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylthiolan-3-amine (PubChem CID 79950813) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylthiolan-3-amine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79950813 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-methylthiolan-3-amine |
| SMILES | CC1CC(NCC2CN3CCCC3CO2)CS1 |
| InChI | InChI=1S/C13H24N2OS/c1-10-5-11(9-17-10)14-6-13-7-15-4-2-3-12(15)8-16-13/h10-14H,2-9H2,1H3 |
| InChIKey | FAMWJXSSSXTKMM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |