C19H35N3O3 — CID 113247906
tert-butyl N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)cyclohexyl]carbamate (PubChem CID 113247906) has the molecular formula C19H35N3O3 and a molecular weight of 353.51 g/mol. Its IUPAC name is tert-butyl N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 113247906 |
| Molecular Formula | C19H35N3O3 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | tert-butyl N-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC(NCC2CN3CCCC3CO2)C1 |
| InChI | InChI=1S/C19H35N3O3/c1-19(2,3)25-18(23)21-15-7-4-6-14(10-15)20-11-17-12-22-9-5-8-16(22)13-24-17/h14-17,20H,4-13H2,1-3H3,(H,21,23) |
| InChIKey | CAHRFSVDRIWOQC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |