C18H21F3N4O2 — CID 75472739
N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 75472739) has the molecular formula C18H21F3N4O2 and a molecular weight of 382.39 g/mol. Its IUPAC name is N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 75472739 |
| Molecular Formula | C18H21F3N4O2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | COc1c(C)cnc(CNC(=O)C2CCn3c(cnc3C(F)(F)F)C2)c1C |
| InChI | InChI=1S/C18H21F3N4O2/c1-10-7-22-14(11(2)15(10)27-3)9-23-16(26)12-4-5-25-13(6-12)8-24-17(25)18(19,20)21/h7-8,12H,4-6,9H2,1-3H3,(H,23,26) |
| InChIKey | HFWBDOKHBKYZQX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |