C21H28ClN3O3 — CID 75472827
6-chloro-1-ethyl-N-(3-methyl-2-morpholin-4-ylbutyl)-4-oxoquinoline-3-carboxamide (PubChem CID 75472827) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is 6-chloro-1-ethyl-N-(3-methyl-2-morpholin-4-ylbutyl)-4-oxoquinoline-3-carboxamide.
| Compound Name | 6-chloro-1-ethyl-N-(3-methyl-2-morpholin-4-ylbutyl)-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 75472827 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 6-chloro-1-ethyl-N-(3-methyl-2-morpholin-4-ylbutyl)-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCC(C(C)C)N2CCOCC2)c(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H28ClN3O3/c1-4-24-13-17(20(26)16-11-15(22)5-6-18(16)24)21(27)23-12-19(14(2)3)25-7-9-28-10-8-25/h5-6,11,13-14,19H,4,7-10,12H2,1-3H3,(H,23,27) |
| InChIKey | ZVUTWJYTTAVDLE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |