C14H17FN4O3 — CID 75473285
2-tert-butyl-4-[(2-fluoro-6-nitrophenyl)methyl]-5-methyl-1,2,4-triazol-3-one (PubChem CID 75473285) has the molecular formula C14H17FN4O3 and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-tert-butyl-4-[(2-fluoro-6-nitrophenyl)methyl]-5-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-tert-butyl-4-[(2-fluoro-6-nitrophenyl)methyl]-5-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 75473285 |
| Molecular Formula | C14H17FN4O3 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-tert-butyl-4-[(2-fluoro-6-nitrophenyl)methyl]-5-methyl-1,2,4-triazol-3-one |
| SMILES | Cc1nn(C(C)(C)C)c(=O)n1Cc1c(F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17FN4O3/c1-9-16-18(14(2,3)4)13(20)17(9)8-10-11(15)6-5-7-12(10)19(21)22/h5-7H,8H2,1-4H3 |
| InChIKey | BQPUADMVOBIPHI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|