C19H34N4O3 — CID 75473864
N-butyl-4-[1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazine-1-carboxamide (PubChem CID 75473864) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-butyl-4-[1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 75473864 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | N-butyl-4-[1-(oxan-4-yl)-2-oxopiperidin-3-yl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(C2CCCN(C3CCOCC3)C2=O)CC1 |
| InChI | InChI=1S/C19H34N4O3/c1-2-3-8-20-19(25)22-12-10-21(11-13-22)17-5-4-9-23(18(17)24)16-6-14-26-15-7-16/h16-17H,2-15H2,1H3,(H,20,25) |
| InChIKey | KOKFVFFLPKUVAW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|