C19H33N5O2 — CID 136520307
N-[(1-butyl-3-methylpyrazol-4-yl)methyl]-4-(oxan-4-yl)piperazine-1-carboxamide (PubChem CID 136520307) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[(1-butyl-3-methylpyrazol-4-yl)methyl]-4-(oxan-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[(1-butyl-3-methylpyrazol-4-yl)methyl]-4-(oxan-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 136520307 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | N-[(1-butyl-3-methylpyrazol-4-yl)methyl]-4-(oxan-4-yl)piperazine-1-carboxamide |
| SMILES | CCCCn1cc(CNC(=O)N2CCN(C3CCOCC3)CC2)c(C)n1 |
| InChI | InChI=1S/C19H33N5O2/c1-3-4-7-24-15-17(16(2)21-24)14-20-19(25)23-10-8-22(9-11-23)18-5-12-26-13-6-18/h15,18H,3-14H2,1-2H3,(H,20,25) |
| InChIKey | UPYVGIVDPSFRND-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |