C23H37N7O2S — CID 146096027
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-[(3-methyl-1-pentylpyrazol-4-yl)methyl]oxamide (PubChem CID 146096027) has the molecular formula C23H37N7O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-[(3-methyl-1-pentylpyrazol-4-yl)methyl]oxamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-[(3-methyl-1-pentylpyrazol-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 146096027 |
| Molecular Formula | C23H37N7O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-N'-[(3-methyl-1-pentylpyrazol-4-yl)methyl]oxamide |
| SMILES | CCCCCn1cc(CNC(=O)C(=O)NCCCc2nnc(SC)n2C2CCCC2)c(C)n1 |
| InChI | InChI=1S/C23H37N7O2S/c1-4-5-8-14-29-16-18(17(2)28-29)15-25-22(32)21(31)24-13-9-12-20-26-27-23(33-3)30(20)19-10-6-7-11-19/h16,19H,4-15H2,1-3H3,(H,24,31)(H,25,32) |
| InChIKey | GBDWIYYOYBBPMV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|