C15H24N4O2S — CID 126795862
N-(5-ethyl-1,3-thiazol-2-yl)-4-(oxan-4-yl)piperazine-1-carboxamide (PubChem CID 126795862) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-(5-ethyl-1,3-thiazol-2-yl)-4-(oxan-4-yl)piperazine-1-carboxamide.
| Compound Name | N-(5-ethyl-1,3-thiazol-2-yl)-4-(oxan-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 126795862 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-(5-ethyl-1,3-thiazol-2-yl)-4-(oxan-4-yl)piperazine-1-carboxamide |
| SMILES | CCc1cnc(NC(=O)N2CCN(C3CCOCC3)CC2)s1 |
| InChI | InChI=1S/C15H24N4O2S/c1-2-13-11-16-14(22-13)17-15(20)19-7-5-18(6-8-19)12-3-9-21-10-4-12/h11-12H,2-10H2,1H3,(H,16,17,20) |
| InChIKey | XGBHXNFISXCPKP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |