C21H28N4OS — CID 126766658
N-(5-benzyl-1,3-thiazol-2-yl)-4-cyclopentyl-1,4-diazepane-1-carboxamide (PubChem CID 126766658) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-4-cyclopentyl-1,4-diazepane-1-carboxamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-4-cyclopentyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 126766658 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-4-cyclopentyl-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2ccccc2)s1)N1CCCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C21H28N4OS/c26-21(25-12-6-11-24(13-14-25)18-9-4-5-10-18)23-20-22-16-19(27-20)15-17-7-2-1-3-8-17/h1-3,7-8,16,18H,4-6,9-15H2,(H,22,23,26) |
| InChIKey | PVEBSLUGWWQYKP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |