C16H19N3O2S — CID 99837165
1-(5-benzyl-1,3-thiazol-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 99837165) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(5-benzyl-1,3-thiazol-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(5-benzyl-1,3-thiazol-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 99837165 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(5-benzyl-1,3-thiazol-2-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCCO1)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C16H19N3O2S/c20-15(17-10-13-7-4-8-21-13)19-16-18-11-14(22-16)9-12-5-2-1-3-6-12/h1-3,5-6,11,13H,4,7-10H2,(H2,17,18,19,20)/t13-/m0/s1 |
| InChIKey | XRTWMLGHGPGCTF-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |