C17H21N3OS — CID 126770563
N-(5-benzyl-1,3-thiazol-2-yl)-3-methylpiperidine-1-carboxamide (PubChem CID 126770563) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-3-methylpiperidine-1-carboxamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 126770563 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)Nc2ncc(Cc3ccccc3)s2)C1 |
| InChI | InChI=1S/C17H21N3OS/c1-13-6-5-9-20(12-13)17(21)19-16-18-11-15(22-16)10-14-7-3-2-4-8-14/h2-4,7-8,11,13H,5-6,9-10,12H2,1H3,(H,18,19,21) |
| InChIKey | QRNKGTVZBAGWNY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |