C23H25N3O3S2 — CID 99142497
N-(5-benzyl-1,3-thiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 99142497) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 99142497 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)Nc3ncc(Cc4ccccc4)s3)cc2)CC1 |
| InChI | InChI=1S/C23H25N3O3S2/c1-17-11-13-26(14-12-17)31(28,29)21-9-7-19(8-10-21)22(27)25-23-24-16-20(30-23)15-18-5-3-2-4-6-18/h2-10,16-17H,11-15H2,1H3,(H,24,25,27) |
| InChIKey | BPHBIPAWLBVLKE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |