C16H21N3O4S — CID 75474370
4-(1-benzoylpiperidin-3-yl)sulfonylpiperazin-2-one (PubChem CID 75474370) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-(1-benzoylpiperidin-3-yl)sulfonylpiperazin-2-one.
| Compound Name | 4-(1-benzoylpiperidin-3-yl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 75474370 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-(1-benzoylpiperidin-3-yl)sulfonylpiperazin-2-one |
| SMILES | O=C1CN(S(=O)(=O)C2CCCN(C(=O)c3ccccc3)C2)CCN1 |
| InChI | InChI=1S/C16H21N3O4S/c20-15-12-19(10-8-17-15)24(22,23)14-7-4-9-18(11-14)16(21)13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2,(H,17,20) |
| InChIKey | RLVJNDBMGVPVCC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |