C17H23NO3S — CID 75476504
1-[3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-4-methylsulfonylphenyl]ethanone (PubChem CID 75476504) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-4-methylsulfonylphenyl]ethanone.
| Compound Name | 1-[3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-4-methylsulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 75476504 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-4-methylsulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(C)(=O)=O)c(N2CC3CCCCC3C2)c1 |
| InChI | InChI=1S/C17H23NO3S/c1-12(19)13-7-8-17(22(2,20)21)16(9-13)18-10-14-5-3-4-6-15(14)11-18/h7-9,14-15H,3-6,10-11H2,1-2H3 |
| InChIKey | UNLLDIBULVJZOM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |