C21H22N6O3S — CID 75478418
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 75478418) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 75478418 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | O=C(COC(=O)C1CC2CCCCC2N1c1ncccn1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C21H22N6O3S/c28-18(24-14-6-3-7-15-19(14)26-31-25-15)12-30-20(29)17-11-13-5-1-2-8-16(13)27(17)21-22-9-4-10-23-21/h3-4,6-7,9-10,13,16-17H,1-2,5,8,11-12H2,(H,24,28) |
| InChIKey | DNUJLPZOFKUAPJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |