About 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide
2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide (PubChem CID 75478741) has the molecular formula C12H11N3O3S2
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide |
| PubChem CID | 75478741 |
| Molecular Formula | C12H11N3O3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide |
| SMILES | Cc1nonc1NS(=O)(=O)c1c(C)sc2ccccc12 |
| InChI | InChI=1S/C12H11N3O3S2/c1-7-12(14-18-13-7)15-20(16,17)11-8(2)19-10-6-4-3-5-9(10)11/h3-6H,1-2H3,(H,14,15) |
| InChIKey | QOCKXFONJMNINR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide?
The IUPAC name of 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide (CID 75478741) is 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide.
What is the SMILES notation for 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide?
The canonical SMILES for 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide is Cc1nonc1NS(=O)(=O)c1c(C)sc2ccccc12.
What is the InChIKey of 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide?
The InChIKey is QOCKXFONJMNINR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O3S2/c1-7-12(14-18-13-7)15-20(16,17)11-8(2)19-10-6-4-3-5-9(10)11/h3-6H,1-2H3,(H,14,15).
What are the key properties of 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide?
2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide has a molecular weight of 309.37 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-3-sulfonamide is sourced from PubChem (CID 75478741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).