C17H14N6O2 — CID 75478777
4-[3-methyl-5-[(4-nitrophenyl)methylamino]-1,2,4-triazol-1-yl]benzonitrile (PubChem CID 75478777) has the molecular formula C17H14N6O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 4-[3-methyl-5-[(4-nitrophenyl)methylamino]-1,2,4-triazol-1-yl]benzonitrile.
| Compound Name | 4-[3-methyl-5-[(4-nitrophenyl)methylamino]-1,2,4-triazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 75478777 |
| Molecular Formula | C17H14N6O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-[3-methyl-5-[(4-nitrophenyl)methylamino]-1,2,4-triazol-1-yl]benzonitrile |
| SMILES | Cc1nc(NCc2ccc([N+](=O)[O-])cc2)n(-c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C17H14N6O2/c1-12-20-17(19-11-14-4-8-16(9-5-14)23(24)25)22(21-12)15-6-2-13(10-18)3-7-15/h2-9H,11H2,1H3,(H,19,20,21) |
| InChIKey | GPJFIVGJVVNJOQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|