C10H23N3O2S — CID 75483805
4-ethyl-N-propan-2-yl-1,4-diazepane-1-sulfonamide (PubChem CID 75483805) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 4-ethyl-N-propan-2-yl-1,4-diazepane-1-sulfonamide.
| Compound Name | 4-ethyl-N-propan-2-yl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 75483805 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-ethyl-N-propan-2-yl-1,4-diazepane-1-sulfonamide |
| SMILES | CCN1CCCN(S(=O)(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C10H23N3O2S/c1-4-12-6-5-7-13(9-8-12)16(14,15)11-10(2)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | ZKEPYGAYVTTWGO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |