C10H11N5O3 — CID 75484284
1-(2-cyanoethyl)-1-methyl-3-(3-nitro-4-pyridinyl)urea (PubChem CID 75484284) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-1-methyl-3-(3-nitro-4-pyridinyl)urea.
| Compound Name | 1-(2-cyanoethyl)-1-methyl-3-(3-nitro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 75484284 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-(2-cyanoethyl)-1-methyl-3-(3-nitro-4-pyridinyl)urea |
| SMILES | CN(CCC#N)C(=O)Nc1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O3/c1-14(6-2-4-11)10(16)13-8-3-5-12-7-9(8)15(17)18/h3,5,7H,2,6H2,1H3,(H,12,13,16) |
| InChIKey | YZRUAKQAEFBGAZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|