C11H22N4O2S — CID 75484912
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-methylpentane-1-sulfonamide (PubChem CID 75484912) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-methylpentane-1-sulfonamide.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-methylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 75484912 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-methylpentane-1-sulfonamide |
| SMILES | CCCCCS(=O)(=O)N(C)Cc1nnc(C)n1C |
| InChI | InChI=1S/C11H22N4O2S/c1-5-6-7-8-18(16,17)14(3)9-11-13-12-10(2)15(11)4/h5-9H2,1-4H3 |
| InChIKey | AZCDTCLVVVFTSJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|