C14H17BF3NO7S — CID 75487449
4,4,5,5-tetramethyl-2-[2-methylsulfonyl-4-nitro-5-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane (PubChem CID 75487449) has the molecular formula C14H17BF3NO7S and a molecular weight of 411.16 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-methylsulfonyl-4-nitro-5-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-methylsulfonyl-4-nitro-5-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 75487449 |
| Molecular Formula | C14H17BF3NO7S |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-methylsulfonyl-4-nitro-5-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(OC(F)(F)F)c([N+](=O)[O-])cc2S(C)(=O)=O)OC1(C)C |
| InChI | InChI=1S/C14H17BF3NO7S/c1-12(2)13(3,4)26-15(25-12)8-6-10(24-14(16,17)18)9(19(20)21)7-11(8)27(5,22)23/h6-7H,1-5H3 |
| InChIKey | DHETWPVOCZGOCW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|