C15H18N4OS — CID 75489815
N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide (PubChem CID 75489815) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 75489815 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCC2)c1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C15H18N4OS/c20-14(17-15-16-11-7-4-8-12(11)21-15)13-9-5-2-1-3-6-10(9)18-19-13/h1-8H2,(H,18,19)(H,16,17,20) |
| InChIKey | WCILKLUDPZRRRN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |