C19H14N2O2S — CID 754915
N-[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide (PubChem CID 754915) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 754915 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[4-(5-methyl-1,3-benzothiazol-2-yl)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc2sc(-c3ccc(NC(=O)c4ccco4)cc3)nc2c1 |
| InChI | InChI=1S/C19H14N2O2S/c1-12-4-9-17-15(11-12)21-19(24-17)13-5-7-14(8-6-13)20-18(22)16-3-2-10-23-16/h2-11H,1H3,(H,20,22) |
| InChIKey | BYXUDVOXPCRVHZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |