C19H20N2O3 — CID 75493606
N-[1-(1-benzofuran-2-yl)ethyl]-1-oxido-N-propylpyridin-1-ium-2-carboxamide (PubChem CID 75493606) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-1-oxido-N-propylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-1-oxido-N-propylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 75493606 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-1-oxido-N-propylpyridin-1-ium-2-carboxamide |
| SMILES | CCCN(C(=O)c1cccc[n+]1[O-])C(C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H20N2O3/c1-3-11-20(19(22)16-9-6-7-12-21(16)23)14(2)18-13-15-8-4-5-10-17(15)24-18/h4-10,12-14H,3,11H2,1-2H3 |
| InChIKey | JDKHWLUPXDBFNS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|