C19H30N2O3S — CID 55905246
N-[1-(1-benzofuran-2-yl)ethyl-methylsulfamoyl]-N-butylbutan-1-amine (PubChem CID 55905246) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl-methylsulfamoyl]-N-butylbutan-1-amine.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl-methylsulfamoyl]-N-butylbutan-1-amine |
|---|---|
| PubChem CID | 55905246 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl-methylsulfamoyl]-N-butylbutan-1-amine |
| SMILES | CCCCN(CCCC)S(=O)(=O)N(C)C(C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H30N2O3S/c1-5-7-13-21(14-8-6-2)25(22,23)20(4)16(3)19-15-17-11-9-10-12-18(17)24-19/h9-12,15-16H,5-8,13-14H2,1-4H3 |
| InChIKey | DSKIDZURVWOWAQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |