C11H11ClFNO3S — CID 75494405
2-chloro-N-(cyclopropylmethylsulfonyl)-3-fluorobenzamide (PubChem CID 75494405) has the molecular formula C11H11ClFNO3S and a molecular weight of 291.73 g/mol. Its IUPAC name is 2-chloro-N-(cyclopropylmethylsulfonyl)-3-fluorobenzamide.
| Compound Name | 2-chloro-N-(cyclopropylmethylsulfonyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 75494405 |
| Molecular Formula | C11H11ClFNO3S |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-chloro-N-(cyclopropylmethylsulfonyl)-3-fluorobenzamide |
| SMILES | O=C(NS(=O)(=O)CC1CC1)c1cccc(F)c1Cl |
| InChI | InChI=1S/C11H11ClFNO3S/c12-10-8(2-1-3-9(10)13)11(15)14-18(16,17)6-7-4-5-7/h1-3,7H,4-6H2,(H,14,15) |
| InChIKey | VGLIWIATHUMYLQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |