C22H19N3O3S — CID 7549452
methyl 4-[[[2-(1H-perimidin-2-ylsulfanyl)acetyl]amino]methyl]benzoate (PubChem CID 7549452) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is methyl 4-[[[2-(1H-perimidin-2-ylsulfanyl)acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-(1H-perimidin-2-ylsulfanyl)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 7549452 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | methyl 4-[[[2-(1H-perimidin-2-ylsulfanyl)acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)CSC2=Nc3cccc4cccc(c34)N2)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-28-21(27)16-10-8-14(9-11-16)12-23-19(26)13-29-22-24-17-6-2-4-15-5-3-7-18(25-22)20(15)17/h2-11H,12-13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | YTHNRZSRKVTFTO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|