C21H17N3O2S — CID 7681164
N-(4-acetylphenyl)-2-(1H-perimidin-2-ylsulfanyl)acetamide (PubChem CID 7681164) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(1H-perimidin-2-ylsulfanyl)acetamide.
| Compound Name | N-(4-acetylphenyl)-2-(1H-perimidin-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 7681164 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(4-acetylphenyl)-2-(1H-perimidin-2-ylsulfanyl)acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSC2=Nc3cccc4cccc(c34)N2)cc1 |
| InChI | InChI=1S/C21H17N3O2S/c1-13(25)14-8-10-16(11-9-14)22-19(26)12-27-21-23-17-6-2-4-15-5-3-7-18(24-21)20(15)17/h2-11H,12H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | ZGTUMYQXXIGJFU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|