C21H18N4O2S — CID 7549589
4-[[(2S)-2-(1H-perimidin-2-ylsulfanyl)propanoyl]amino]benzamide (PubChem CID 7549589) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[[(2S)-2-(1H-perimidin-2-ylsulfanyl)propanoyl]amino]benzamide.
| Compound Name | 4-[[(2S)-2-(1H-perimidin-2-ylsulfanyl)propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 7549589 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[[(2S)-2-(1H-perimidin-2-ylsulfanyl)propanoyl]amino]benzamide |
| SMILES | C[C@H](SC1=Nc2cccc3cccc(c23)N1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c1-12(20(27)23-15-10-8-14(9-11-15)19(22)26)28-21-24-16-6-2-4-13-5-3-7-17(25-21)18(13)16/h2-12H,1H3,(H2,22,26)(H,23,27)(H,24,25)/t12-/m0/s1 |
| InChIKey | DQOKYOWOACAGAQ-LBPRGKRZSA-N |
| XLogP | 4.11 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|