C13H10F4N2O2 — CID 75494549
2-(1-methylpyrazol-4-yl)ethyl 2,3,5,6-tetrafluorobenzoate (PubChem CID 75494549) has the molecular formula C13H10F4N2O2 and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)ethyl 2,3,5,6-tetrafluorobenzoate.
| Compound Name | 2-(1-methylpyrazol-4-yl)ethyl 2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 75494549 |
| Molecular Formula | C13H10F4N2O2 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)ethyl 2,3,5,6-tetrafluorobenzoate |
| SMILES | Cn1cc(CCOC(=O)c2c(F)c(F)cc(F)c2F)cn1 |
| InChI | InChI=1S/C13H10F4N2O2/c1-19-6-7(5-18-19)2-3-21-13(20)10-11(16)8(14)4-9(15)12(10)17/h4-6H,2-3H2,1H3 |
| InChIKey | RGAODXRNDJGOFJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|