C16H33N5 — CID 75495270
N'-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]azepane-1-carboximidamide (PubChem CID 75495270) has the molecular formula C16H33N5 and a molecular weight of 295.47 g/mol. Its IUPAC name is N'-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]azepane-1-carboximidamide.
| Compound Name | N'-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 75495270 |
| Molecular Formula | C16H33N5 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.27 |
| IUPAC Name | N'-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]azepane-1-carboximidamide |
| SMILES | CN(C)C1CCN(CC/N=C(\N)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C16H33N5/c1-19(2)15-7-12-20(13-8-15)14-9-18-16(17)21-10-5-3-4-6-11-21/h15H,3-14H2,1-2H3,(H2,17,18) |
| InChIKey | FBHHAYBXIIUHBT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|