C14H24ClN3O3 — CID 75495709
1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 75495709) has the molecular formula C14H24ClN3O3 and a molecular weight of 317.82 g/mol. Its IUPAC name is 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 75495709 |
| Molecular Formula | C14H24ClN3O3 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC(C)N1C(=O)CC(NC(=O)C2(N)CCCCC2)C1=O.Cl |
| InChI | InChI=1S/C14H23N3O3.ClH/c1-9(2)17-11(18)8-10(12(17)19)16-13(20)14(15)6-4-3-5-7-14;/h9-10H,3-8,15H2,1-2H3,(H,16,20);1H |
| InChIKey | YVAIGIYHFUMXJY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|