About 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride
1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 75495709) has the molecular formula C14H24ClN3O3
and a molecular weight of 317.82 g/mol. Its IUPAC name is 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride |
| PubChem CID | 75495709 |
| Molecular Formula | C14H24ClN3O3 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC(C)N1C(=O)CC(NC(=O)C2(N)CCCCC2)C1=O.Cl |
| InChI | InChI=1S/C14H23N3O3.ClH/c1-9(2)17-11(18)8-10(12(17)19)16-13(20)14(15)6-4-3-5-7-14;/h9-10H,3-8,15H2,1-2H3,(H,16,20);1H |
| InChIKey | YVAIGIYHFUMXJY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride?
The IUPAC name of 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride (CID 75495709) is 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride.
What is the SMILES notation for 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride?
The canonical SMILES for 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride is CC(C)N1C(=O)CC(NC(=O)C2(N)CCCCC2)C1=O.Cl.
What is the InChIKey of 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride?
The InChIKey is YVAIGIYHFUMXJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3.ClH/c1-9(2)17-11(18)8-10(12(17)19)16-13(20)14(15)6-4-3-5-7-14;/h9-10H,3-8,15H2,1-2H3,(H,16,20);1H.
What are the key properties of 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride?
1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride has a molecular weight of 317.82 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)cyclohexane-1-carboxamide;hydrochloride is sourced from PubChem (CID 75495709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).