C14H18N2O3S — CID 98343599
(2R)-N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-thiophen-3-ylpropanamide (PubChem CID 98343599) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (2R)-N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-thiophen-3-ylpropanamide.
| Compound Name | (2R)-N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 98343599 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R)-N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-thiophen-3-ylpropanamide |
| SMILES | CC(C)N1C(=O)C[C@@H](NC(=O)[C@H](C)c2ccsc2)C1=O |
| InChI | InChI=1S/C14H18N2O3S/c1-8(2)16-12(17)6-11(14(16)19)15-13(18)9(3)10-4-5-20-7-10/h4-5,7-9,11H,6H2,1-3H3,(H,15,18)/t9-,11-/m1/s1 |
| InChIKey | HMYHPWNAGURLGD-MWLCHTKSSA-N |
| XLogP | 1.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|