C14H23N3O3 — CID 71852782
1-cyclohexyl-3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)urea (PubChem CID 71852782) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-cyclohexyl-3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 71852782 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-cyclohexyl-3-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)urea |
| SMILES | CC(C)N1C(=O)CC(NC(=O)NC2CCCCC2)C1=O |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)17-12(18)8-11(13(17)19)16-14(20)15-10-6-4-3-5-7-10/h9-11H,3-8H2,1-2H3,(H2,15,16,20) |
| InChIKey | FWXKNAKHRQOPEF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|