C13H17N3O3 — CID 98218270
N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-methyl-1H-pyrrole-3-carboxamide (PubChem CID 98218270) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 98218270 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[(3R)-2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl]-2-methyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]ccc1C(=O)N[C@@H]1CC(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C13H17N3O3/c1-7(2)16-11(17)6-10(13(16)19)15-12(18)9-4-5-14-8(9)3/h4-5,7,10,14H,6H2,1-3H3,(H,15,18)/t10-/m1/s1 |
| InChIKey | BODXGTFMEPPEFN-SNVBAGLBSA-N |
| XLogP | 0.59 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|