C13H23NO3 — CID 75496206
2-ethyl-2-[[[(Z)-2-methylpent-2-enoyl]amino]methyl]butanoic acid (PubChem CID 75496206) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-ethyl-2-[[[(Z)-2-methylpent-2-enoyl]amino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[(Z)-2-methylpent-2-enoyl]amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 75496206 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-ethyl-2-[[[(Z)-2-methylpent-2-enoyl]amino]methyl]butanoic acid |
| SMILES | CC/C=C(/C)C(=O)NCC(CC)(CC)C(=O)O |
| InChI | InChI=1S/C13H23NO3/c1-5-8-10(4)11(15)14-9-13(6-2,7-3)12(16)17/h8H,5-7,9H2,1-4H3,(H,14,15)(H,16,17)/b10-8- |
| InChIKey | HWVPFVQGWDUDGI-NTMALXAHSA-N |
| XLogP | 2.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|