About (3-cyanocyclopentyl) quinoline-5-carboxylate
(3-cyanocyclopentyl) quinoline-5-carboxylate (PubChem CID 75497503) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is (3-cyanocyclopentyl) quinoline-5-carboxylate.
Molecular Properties
| Compound Name | (3-cyanocyclopentyl) quinoline-5-carboxylate |
| PubChem CID | 75497503 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3-cyanocyclopentyl) quinoline-5-carboxylate |
| SMILES | N#CC1CCC(OC(=O)c2cccc3ncccc23)C1 |
| InChI | InChI=1S/C16H14N2O2/c17-10-11-6-7-12(9-11)20-16(19)14-3-1-5-15-13(14)4-2-8-18-15/h1-5,8,11-12H,6-7,9H2 |
| InChIKey | YZGAAZZREQZWMC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-cyanocyclopentyl) quinoline-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyanocyclopentyl) quinoline-5-carboxylate?
The IUPAC name of (3-cyanocyclopentyl) quinoline-5-carboxylate (CID 75497503) is (3-cyanocyclopentyl) quinoline-5-carboxylate.
What is the SMILES notation for (3-cyanocyclopentyl) quinoline-5-carboxylate?
The canonical SMILES for (3-cyanocyclopentyl) quinoline-5-carboxylate is N#CC1CCC(OC(=O)c2cccc3ncccc23)C1.
What is the InChIKey of (3-cyanocyclopentyl) quinoline-5-carboxylate?
The InChIKey is YZGAAZZREQZWMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c17-10-11-6-7-12(9-11)20-16(19)14-3-1-5-15-13(14)4-2-8-18-15/h1-5,8,11-12H,6-7,9H2.
What are the key properties of (3-cyanocyclopentyl) quinoline-5-carboxylate?
(3-cyanocyclopentyl) quinoline-5-carboxylate has a molecular weight of 266.30 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyanocyclopentyl) quinoline-5-carboxylate is sourced from PubChem (CID 75497503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).