C14H13ClFNO2S — CID 75498486
N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-2-thiophen-2-ylacetamide (PubChem CID 75498486) has the molecular formula C14H13ClFNO2S and a molecular weight of 313.78 g/mol. Its IUPAC name is N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 75498486 |
| Molecular Formula | C14H13ClFNO2S |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NC(CO)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H13ClFNO2S/c15-11-4-3-9(6-12(11)16)13(8-18)17-14(19)7-10-2-1-5-20-10/h1-6,13,18H,7-8H2,(H,17,19) |
| InChIKey | MEFZZZQYLRUKJU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |