C17H30N4O2 — CID 75499262
1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-pentan-3-yloxan-4-yl)urea (PubChem CID 75499262) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-pentan-3-yloxan-4-yl)urea.
| Compound Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-pentan-3-yloxan-4-yl)urea |
|---|---|
| PubChem CID | 75499262 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(2-pentan-3-yloxan-4-yl)urea |
| SMILES | CCC(CC)C1CC(NC(=O)NCc2cnn(C)c2C)CCO1 |
| InChI | InChI=1S/C17H30N4O2/c1-5-13(6-2)16-9-15(7-8-23-16)20-17(22)18-10-14-11-19-21(4)12(14)3/h11,13,15-16H,5-10H2,1-4H3,(H2,18,20,22) |
| InChIKey | XPWLCCNEMCMPCF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |